Carboxylic acids and derivatives
Filtered Search Results
Clomiphene citrate
CAS: 50-41-9 Molecular Formula: C32H36ClNO8 Molecular Weight (g/mol): 598.089 MDL Number: MFCD00058322 InChI Key: PYTMYKVIJXPNBD-BTKVJIOYSA-N Synonym: clomifene citrate,clomiphene citrate,clomid,cis-clomiphene citrate,clomiphene a citrate,zuclomid,chloramiphene,milophene,serophene,z-clomiphene citrate PubChem CID: 6420009 IUPAC Name: 2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: CCN(CC)CCOC1=CC=C(C=C1)C(=C(C2=CC=CC=C2)Cl)C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O
| PubChem CID | 6420009 |
|---|---|
| CAS | 50-41-9 |
| Molecular Weight (g/mol) | 598.089 |
| MDL Number | MFCD00058322 |
| SMILES | CCN(CC)CCOC1=CC=C(C=C1)C(=C(C2=CC=CC=C2)Cl)C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Synonym | clomifene citrate,clomiphene citrate,clomid,cis-clomiphene citrate,clomiphene a citrate,zuclomid,chloramiphene,milophene,serophene,z-clomiphene citrate |
| IUPAC Name | 2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | PYTMYKVIJXPNBD-BTKVJIOYSA-N |
| Molecular Formula | C32H36ClNO8 |
Ethyl cyanoacetate, 98+%
CAS: 105-56-6 Molecular Formula: C5H7NO2 Molecular Weight (g/mol): 113.12 MDL Number: MFCD00001940 InChI Key: ZIUSEGSNTOUIPT-UHFFFAOYSA-N Synonym: ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate PubChem CID: 7764 IUPAC Name: ethyl 2-cyanoacetate SMILES: CCOC(=O)CC#N
| PubChem CID | 7764 |
|---|---|
| CAS | 105-56-6 |
| Molecular Weight (g/mol) | 113.12 |
| MDL Number | MFCD00001940 |
| SMILES | CCOC(=O)CC#N |
| Synonym | ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate |
| IUPAC Name | ethyl 2-cyanoacetate |
| InChI Key | ZIUSEGSNTOUIPT-UHFFFAOYSA-N |
| Molecular Formula | C5H7NO2 |
1-Cyclohexene-1-acetic acid
CAS: 18294-87-6 Molecular Formula: C8H12O2 Molecular Weight (g/mol): 140.182 MDL Number: MFCD00015482 InChI Key: KDFBPHXESBPHTK-UHFFFAOYSA-N Synonym: 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid PubChem CID: 86699 IUPAC Name: 2-(cyclohexen-1-yl)acetic acid SMILES: C1CCC(=CC1)CC(=O)O
| PubChem CID | 86699 |
|---|---|
| CAS | 18294-87-6 |
| Molecular Weight (g/mol) | 140.182 |
| MDL Number | MFCD00015482 |
| SMILES | C1CCC(=CC1)CC(=O)O |
| Synonym | 1-cyclohexenylacetic acid,1-cyclohexene-1-acetic acid,2-cyclohex-1-en-1-yl acetic acid,cyclohex-1-enylacetic acid,1-cyclohexene-1-aceticacid,2-cyclohexen-1-yl acetic acid,2-cyclohex-1-enylacetic acid,cyclohex-1-en-1-ylacetic acid,1-cyclohexenylacetate,cyclohexenylacetic acid |
| IUPAC Name | 2-(cyclohexen-1-yl)acetic acid |
| InChI Key | KDFBPHXESBPHTK-UHFFFAOYSA-N |
| Molecular Formula | C8H12O2 |
Dilauroyl peroxide, 99%
CAS: 105-74-8 Molecular Formula: C24H46O4 Molecular Weight (g/mol): 398.63 MDL Number: MFCD00008964 InChI Key: YIVJZNGAASQVEM-UHFFFAOYSA-N Synonym: lauroyl peroxide,dilauroyl peroxide,dodecanoyl peroxide,peroxide, bis 1-oxododecyl,laurydol,laurox,alperox c,dodecanoic peroxyanhydride,dyp-97f,peroxyde de lauroyle PubChem CID: 7773 ChEBI: CHEBI:82479 IUPAC Name: dodecanoyl dodecaneperoxoate SMILES: CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC
| PubChem CID | 7773 |
|---|---|
| CAS | 105-74-8 |
| Molecular Weight (g/mol) | 398.63 |
| ChEBI | CHEBI:82479 |
| MDL Number | MFCD00008964 |
| SMILES | CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC |
| Synonym | lauroyl peroxide,dilauroyl peroxide,dodecanoyl peroxide,peroxide, bis 1-oxododecyl,laurydol,laurox,alperox c,dodecanoic peroxyanhydride,dyp-97f,peroxyde de lauroyle |
| IUPAC Name | dodecanoyl dodecaneperoxoate |
| InChI Key | YIVJZNGAASQVEM-UHFFFAOYSA-N |
| Molecular Formula | C24H46O4 |
Calcium Formate, 98%, Pure
CAS: 544-17-2 Molecular Formula: C2H2CaO4 Molecular Weight (g/mol): 130.11 MDL Number: MFCD00036108 InChI Key: CBOCVOKPQGJKKJ-UHFFFAOYSA-L Synonym: calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 PubChem CID: 10997 ChEBI: CHEBI:81851 IUPAC Name: calcium;diformate SMILES: C(=O)[O-].C(=O)[O-].[Ca+2]
| PubChem CID | 10997 |
|---|---|
| CAS | 544-17-2 |
| Molecular Weight (g/mol) | 130.11 |
| ChEBI | CHEBI:81851 |
| MDL Number | MFCD00036108 |
| SMILES | C(=O)[O-].C(=O)[O-].[Ca+2] |
| Synonym | calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 |
| IUPAC Name | calcium;diformate |
| InChI Key | CBOCVOKPQGJKKJ-UHFFFAOYSA-L |
| Molecular Formula | C2H2CaO4 |
Edetate Disodium, Dihydrate, BiotechGrade, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Ethyl 3-methyl-2-oxobutyrate, 95%
CAS: 20201-24-5 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00009122 InChI Key: CKTYYUQUWFEUCO-UHFFFAOYSA-N Synonym: ethyl 3-methyl-2-oxobutyrate,ethyl dimethylpyruvate,ethyl 2-oxo-3-methylbutanoate,butanoic acid, 3-methyl-2-oxo-, ethyl ester,acmc-20akzg,ketovaline ethyl ester,pubchem18179,ethyl3-methyl-2-oxobutanoate,ethyl 2-methyl-2-oxobutyrate,ethyl-3-methyl-2-oxobutanoate PubChem CID: 88406 IUPAC Name: ethyl 3-methyl-2-oxobutanoate SMILES: CCOC(=O)C(=O)C(C)C
| PubChem CID | 88406 |
|---|---|
| CAS | 20201-24-5 |
| Molecular Weight (g/mol) | 144.17 |
| MDL Number | MFCD00009122 |
| SMILES | CCOC(=O)C(=O)C(C)C |
| Synonym | ethyl 3-methyl-2-oxobutyrate,ethyl dimethylpyruvate,ethyl 2-oxo-3-methylbutanoate,butanoic acid, 3-methyl-2-oxo-, ethyl ester,acmc-20akzg,ketovaline ethyl ester,pubchem18179,ethyl3-methyl-2-oxobutanoate,ethyl 2-methyl-2-oxobutyrate,ethyl-3-methyl-2-oxobutanoate |
| IUPAC Name | ethyl 3-methyl-2-oxobutanoate |
| InChI Key | CKTYYUQUWFEUCO-UHFFFAOYSA-N |
| Molecular Formula | C7H12O3 |
beta-D-Ribofuranose 1,2,3,5-tetraacetate, 98+%
CAS: 13035-61-5 Molecular Formula: C13H18O9 Molecular Weight (g/mol): 318.278 MDL Number: MFCD00005358 InChI Key: IHNHAHWGVLXCCI-FDYHWXHSSA-N Synonym: beta-d-ribofuranose 1,2,3,5-tetraacetate,tetra-o-acetyl-beta-d-ribofuranose,1,2,3,5-tetra-o-acetyl-beta-d-ribofuranose,tetraacetylribose,1,2,3,5-tetraacetyl-.-d-ribofuranose,tetra-o-acetyl-b-d-ribofuranose,1,2,3,5-tetraacetyl-beta-d-ribofuranose,1,2,3,5-tetra-o-acetyl-b-d-ribofuranose,.beta.-d-ribofuranose, tetraacetate,ribofuranose, tetraacetate, .beta.-d PubChem CID: 83064 IUPAC Name: [(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate SMILES: CC(=O)OCC1C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C
| PubChem CID | 83064 |
|---|---|
| CAS | 13035-61-5 |
| Molecular Weight (g/mol) | 318.278 |
| MDL Number | MFCD00005358 |
| SMILES | CC(=O)OCC1C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C |
| Synonym | beta-d-ribofuranose 1,2,3,5-tetraacetate,tetra-o-acetyl-beta-d-ribofuranose,1,2,3,5-tetra-o-acetyl-beta-d-ribofuranose,tetraacetylribose,1,2,3,5-tetraacetyl-.-d-ribofuranose,tetra-o-acetyl-b-d-ribofuranose,1,2,3,5-tetraacetyl-beta-d-ribofuranose,1,2,3,5-tetra-o-acetyl-b-d-ribofuranose,.beta.-d-ribofuranose, tetraacetate,ribofuranose, tetraacetate, .beta.-d |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]methyl acetate |
| InChI Key | IHNHAHWGVLXCCI-FDYHWXHSSA-N |
| Molecular Formula | C13H18O9 |
Ethylenediaminetetraacetic acid manganese disodium salt hydrate
CAS: 15375-84-5 Molecular Formula: C10H12MnN2Na2O8 Molecular Weight (g/mol): 389.13 MDL Number: MFCD00661156 InChI Key: ZQHKAIDDHTYINE-UHFFFAOYSA-J Synonym: disodium manganese edta,edta disodium manganese salt,disodium manganese ethylenediaminetetraacetate,manganese disodium ethylene diamine tetraacetate,ethylenediaminetetraacetic acid, disodium manganese salt,disodium ethylenedinitrilo tetraacetato manganese,manganate 2-, disodium,glycine,n'-1,2-ethanediylbis n-carboxymethyl-, manganese disodium salt,manganate 2-,n'-1,2-ethanediylbis n-carboxymethyl glycinato 4--n,n',o,o',on,on'-, disodium, oc-6-21 PubChem CID: 5148022 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;manganese(2+) SMILES: [Na+].[Na+].[Mn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 5148022 |
|---|---|
| CAS | 15375-84-5 |
| Molecular Weight (g/mol) | 389.13 |
| MDL Number | MFCD00661156 |
| SMILES | [Na+].[Na+].[Mn++].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | disodium manganese edta,edta disodium manganese salt,disodium manganese ethylenediaminetetraacetate,manganese disodium ethylene diamine tetraacetate,ethylenediaminetetraacetic acid, disodium manganese salt,disodium ethylenedinitrilo tetraacetato manganese,manganate 2-, disodium,glycine,n'-1,2-ethanediylbis n-carboxymethyl-, manganese disodium salt,manganate 2-,n'-1,2-ethanediylbis n-carboxymethyl glycinato 4--n,n',o,o',on,on'-, disodium, oc-6-21 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;manganese(2+) |
| InChI Key | ZQHKAIDDHTYINE-UHFFFAOYSA-J |
| Molecular Formula | C10H12MnN2Na2O8 |
Cycloheptanecarboxylic acid, 95%
CAS: 1460-16-8 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD00004152 InChI Key: VZFUCHSFHOYXIS-UHFFFAOYSA-N Synonym: cycloheptane carboxylic acid,cycloheptanoic acid,cycloheptanecarboxylicacid,cyclohepatan carboxylic acid,acmc-1c1rc,sampl4, o9,vzfuchsfhoyxis-uhfffaoysa,cycloheptanecarboxylic acid PubChem CID: 15091 ChEBI: CHEBI:29564 IUPAC Name: cycloheptanecarboxylic acid SMILES: OC(=O)C1CCCCCC1
| PubChem CID | 15091 |
|---|---|
| CAS | 1460-16-8 |
| Molecular Weight (g/mol) | 142.20 |
| ChEBI | CHEBI:29564 |
| MDL Number | MFCD00004152 |
| SMILES | OC(=O)C1CCCCCC1 |
| Synonym | cycloheptane carboxylic acid,cycloheptanoic acid,cycloheptanecarboxylicacid,cyclohepatan carboxylic acid,acmc-1c1rc,sampl4, o9,vzfuchsfhoyxis-uhfffaoysa,cycloheptanecarboxylic acid |
| IUPAC Name | cycloheptanecarboxylic acid |
| InChI Key | VZFUCHSFHOYXIS-UHFFFAOYSA-N |
| Molecular Formula | C8H14O2 |
n-Pentyl acetate, 99%
CAS: 628-63-7 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.187 MDL Number: MFCD00009500 InChI Key: PGMYKACGEOXYJE-UHFFFAOYSA-N Synonym: amyl acetate,n-amyl acetate,acetic acid, pentyl ester,n-pentyl acetate,amyl acetic ester,1-pentyl acetate,n-pentyl ethanoate,birnenoel,pent-acetate,amyl acetic ether PubChem CID: 12348 ChEBI: CHEBI:87362 IUPAC Name: pentyl acetate SMILES: CCCCCOC(=O)C
| PubChem CID | 12348 |
|---|---|
| CAS | 628-63-7 |
| Molecular Weight (g/mol) | 130.187 |
| ChEBI | CHEBI:87362 |
| MDL Number | MFCD00009500 |
| SMILES | CCCCCOC(=O)C |
| Synonym | amyl acetate,n-amyl acetate,acetic acid, pentyl ester,n-pentyl acetate,amyl acetic ester,1-pentyl acetate,n-pentyl ethanoate,birnenoel,pent-acetate,amyl acetic ether |
| IUPAC Name | pentyl acetate |
| InChI Key | PGMYKACGEOXYJE-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
(Ethylenedinitrilo)tetraacetic Acid Disodium, Dihydrate, Reagent, ACS, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Trimethylacetic acid, 99%
CAS: 75-98-9 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00004194 InChI Key: IUGYQRQAERSCNH-UHFFFAOYSA-N Synonym: pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid PubChem CID: 6417 ChEBI: CHEBI:45133 IUPAC Name: 2,2-dimethylpropanoic acid SMILES: CC(C)(C)C(=O)O
| PubChem CID | 6417 |
|---|---|
| CAS | 75-98-9 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:45133 |
| MDL Number | MFCD00004194 |
| SMILES | CC(C)(C)C(=O)O |
| Synonym | pivalic acid,trimethylacetic acid,neopentanoic acid,2,2-dimethylpropionic acid,tert-pentanoic acid,propanoic acid, 2,2-dimethyl,versatic 5,kyselina pivalova,acetic acid, trimethyl,alpha,alpha-dimethylpropionic acid |
| IUPAC Name | 2,2-dimethylpropanoic acid |
| InChI Key | IUGYQRQAERSCNH-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
BAPTA tetramethyl ester, 99%
CAS: 125367-34-2 Molecular Formula: C26H32N2O10 Molecular Weight (g/mol): 532.55 MDL Number: MFCD00532664 InChI Key: LCPLRKMZANZSAJ-UHFFFAOYSA-N Synonym: bapta-tetramethyl ester,tetramethyl 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,tetramethyl 1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetate,methyl 2-2-2-2-bis 2-methoxy-2-oxoethyl amino phenoxy ethoxy phenyl 2-methoxy-2-oxoethyl amino acetate,1,2-bis 2-bis 2-oxo-2-methoxyethyl amino phenoxy ethane,tetramethyl 1,2-bis 2-aminophenoxy ethane-n,n,n,n-tetraacetate,1,2-bis 2-aminophenoxy ethane-n,n,n,n-tetraacetic acid, tetramethyl ester,glycine, n,n'-1,2-ethanediylbis oxy-2,1-phenylene bis n-2-methoxy-2-oxoethyl-, 1,1'-dimethyl ester,methyl 2-2-2-2-bis 2-methoxy-2-oxoethyl amino phenoxy ethoxy-n-2-methoxy-2-oxoethyl anilino acetate,n,n'-1,2-ethanediylbis oxy-2,1-phenylene bis n-2-methoxy-2-oxoethyl glycine 1,1'-dimethyl ester PubChem CID: 3452402 IUPAC Name: methyl 2-{[2-(2-{2-[bis(2-methoxy-2-oxoethyl)amino]phenoxy}ethoxy)phenyl](2-methoxy-2-oxoethyl)amino}acetate SMILES: COC(=O)CN(CC(=O)OC)C1=CC=CC=C1OCCOC1=CC=CC=C1N(CC(=O)OC)CC(=O)OC
| PubChem CID | 3452402 |
|---|---|
| CAS | 125367-34-2 |
| Molecular Weight (g/mol) | 532.55 |
| MDL Number | MFCD00532664 |
| SMILES | COC(=O)CN(CC(=O)OC)C1=CC=CC=C1OCCOC1=CC=CC=C1N(CC(=O)OC)CC(=O)OC |
| Synonym | bapta-tetramethyl ester,tetramethyl 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,tetramethyl 1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetate,methyl 2-2-2-2-bis 2-methoxy-2-oxoethyl amino phenoxy ethoxy phenyl 2-methoxy-2-oxoethyl amino acetate,1,2-bis 2-bis 2-oxo-2-methoxyethyl amino phenoxy ethane,tetramethyl 1,2-bis 2-aminophenoxy ethane-n,n,n,n-tetraacetate,1,2-bis 2-aminophenoxy ethane-n,n,n,n-tetraacetic acid, tetramethyl ester,glycine, n,n'-1,2-ethanediylbis oxy-2,1-phenylene bis n-2-methoxy-2-oxoethyl-, 1,1'-dimethyl ester,methyl 2-2-2-2-bis 2-methoxy-2-oxoethyl amino phenoxy ethoxy-n-2-methoxy-2-oxoethyl anilino acetate,n,n'-1,2-ethanediylbis oxy-2,1-phenylene bis n-2-methoxy-2-oxoethyl glycine 1,1'-dimethyl ester |
| IUPAC Name | methyl 2-{[2-(2-{2-[bis(2-methoxy-2-oxoethyl)amino]phenoxy}ethoxy)phenyl](2-methoxy-2-oxoethyl)amino}acetate |
| InChI Key | LCPLRKMZANZSAJ-UHFFFAOYSA-N |
| Molecular Formula | C26H32N2O10 |
Propyl Gallate, NF, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 121-79-9 Molecular Weight (g/mol): 212.2 InChI Key: ZTHYODDOHIVTJV-UHFFFAOYSA-N IUPAC Name: propyl 3,4,5-trihydroxybenzoate SMILES: CCCOC(=O)C1=CC(O)=C(O)C(O)=C1
| CAS | 121-79-9 |
|---|---|
| Molecular Weight (g/mol) | 212.2 |
| SMILES | CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 |
| IUPAC Name | propyl 3,4,5-trihydroxybenzoate |
| InChI Key | ZTHYODDOHIVTJV-UHFFFAOYSA-N |